C19H23N3O5S — CID 50766279
5-(methanesulfonamido)-2-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid (PubChem CID 50766279) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is 5-(methanesulfonamido)-2-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 5-(methanesulfonamido)-2-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50766279 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 5-(methanesulfonamido)-2-[4-(4-methoxyphenyl)piperazin-1-yl]benzoic acid |
| SMILES | COc1ccc(N2CCN(c3ccc(NS(C)(=O)=O)cc3C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-27-16-6-4-15(5-7-16)21-9-11-22(12-10-21)18-8-3-14(20-28(2,25)26)13-17(18)19(23)24/h3-8,13,20H,9-12H2,1-2H3,(H,23,24) |
| InChIKey | RRZMFPMFAZUHJC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|