C13H19N3O4S — CID 50766134
5-(methanesulfonamido)-2-(4-methylpiperazin-1-yl)benzoic acid (PubChem CID 50766134) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 5-(methanesulfonamido)-2-(4-methylpiperazin-1-yl)benzoic acid.
| Compound Name | 5-(methanesulfonamido)-2-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50766134 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-(methanesulfonamido)-2-(4-methylpiperazin-1-yl)benzoic acid |
| SMILES | CN1CCN(c2ccc(NS(C)(=O)=O)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C13H19N3O4S/c1-15-5-7-16(8-6-15)12-4-3-10(14-21(2,19)20)9-11(12)13(17)18/h3-4,9,14H,5-8H2,1-2H3,(H,17,18) |
| InChIKey | GTJLPENEQZHIPP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|