C18H21N3O4S — CID 50766128
5-(benzenesulfonamido)-2-(4-methylpiperazin-1-yl)benzoic acid (PubChem CID 50766128) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-(4-methylpiperazin-1-yl)benzoic acid.
| Compound Name | 5-(benzenesulfonamido)-2-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50766128 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5-(benzenesulfonamido)-2-(4-methylpiperazin-1-yl)benzoic acid |
| SMILES | CN1CCN(c2ccc(NS(=O)(=O)c3ccccc3)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C18H21N3O4S/c1-20-9-11-21(12-10-20)17-8-7-14(13-16(17)18(22)23)19-26(24,25)15-5-3-2-4-6-15/h2-8,13,19H,9-12H2,1H3,(H,22,23) |
| InChIKey | BLLXPQZSFDGHRL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|