C18H20N2O4S — CID 169370562
5-[(4-methylphenyl)sulfonylamino]-2-pyrrolidin-1-ylbenzoic acid (PubChem CID 169370562) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 5-[(4-methylphenyl)sulfonylamino]-2-pyrrolidin-1-ylbenzoic acid.
| Compound Name | 5-[(4-methylphenyl)sulfonylamino]-2-pyrrolidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 169370562 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-[(4-methylphenyl)sulfonylamino]-2-pyrrolidin-1-ylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCCC3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-13-4-7-15(8-5-13)25(23,24)19-14-6-9-17(16(12-14)18(21)22)20-10-2-3-11-20/h4-9,12,19H,2-3,10-11H2,1H3,(H,21,22) |
| InChIKey | IDTPTBVEKGSRHJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|