C25H33N3O4S — CID 50766785
5-[(3,4-dimethylphenyl)sulfonylamino]-2-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid (PubChem CID 50766785) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenyl)sulfonylamino]-2-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid.
| Compound Name | 5-[(3,4-dimethylphenyl)sulfonylamino]-2-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50766785 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 5-[(3,4-dimethylphenyl)sulfonylamino]-2-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCC(N4CCCCC4)CC3)c(C(=O)O)c2)cc1C |
| InChI | InChI=1S/C25H33N3O4S/c1-18-6-8-22(16-19(18)2)33(31,32)26-20-7-9-24(23(17-20)25(29)30)28-14-10-21(11-15-28)27-12-4-3-5-13-27/h6-9,16-17,21,26H,3-5,10-15H2,1-2H3,(H,29,30) |
| InChIKey | XTBJYYSFJUAYTN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|