C24H31N3O4S — CID 50767022
3-[(4-methylphenyl)sulfonylamino]-4-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid (PubChem CID 50767022) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]-4-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]-4-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50767022 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]-4-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(=O)O)ccc2N2CCC(N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O4S/c1-18-5-8-21(9-6-18)32(30,31)25-22-17-19(24(28)29)7-10-23(22)27-15-11-20(12-16-27)26-13-3-2-4-14-26/h5-10,17,20,25H,2-4,11-16H2,1H3,(H,28,29) |
| InChIKey | PRDDDQGGYOXXNE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |