C25H33N3O4S — CID 46291824
4-(4-cyclohexylpiperazin-1-yl)-3-[(3,4-dimethylphenyl)sulfonylamino]benzoic acid (PubChem CID 46291824) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 4-(4-cyclohexylpiperazin-1-yl)-3-[(3,4-dimethylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-(4-cyclohexylpiperazin-1-yl)-3-[(3,4-dimethylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46291824 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-(4-cyclohexylpiperazin-1-yl)-3-[(3,4-dimethylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(=O)O)ccc2N2CCN(C3CCCCC3)CC2)cc1C |
| InChI | InChI=1S/C25H33N3O4S/c1-18-8-10-22(16-19(18)2)33(31,32)26-23-17-20(25(29)30)9-11-24(23)28-14-12-27(13-15-28)21-6-4-3-5-7-21/h8-11,16-17,21,26H,3-7,12-15H2,1-2H3,(H,29,30) |
| InChIKey | NAVPPJFZCNJIMD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |