C23H28FN3O4S — CID 50767050
3-[(3-fluorophenyl)sulfonylamino]-4-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid (PubChem CID 50767050) has the molecular formula C23H28FN3O4S and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)sulfonylamino]-4-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid.
| Compound Name | 3-[(3-fluorophenyl)sulfonylamino]-4-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50767050 |
| Molecular Formula | C23H28FN3O4S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 3-[(3-fluorophenyl)sulfonylamino]-4-(4-piperidin-1-ylpiperidin-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCC(N3CCCCC3)CC2)c(NS(=O)(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C23H28FN3O4S/c24-18-5-4-6-20(16-18)32(30,31)25-21-15-17(23(28)29)7-8-22(21)27-13-9-19(10-14-27)26-11-2-1-3-12-26/h4-8,15-16,19,25H,1-3,9-14H2,(H,28,29) |
| InChIKey | PRESRTJGUKNOQX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |