C18H20FN3O4S — CID 46291743
3-[(3-fluorophenyl)sulfonylamino]-4-(4-methylpiperazin-1-yl)benzoic acid (PubChem CID 46291743) has the molecular formula C18H20FN3O4S and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)sulfonylamino]-4-(4-methylpiperazin-1-yl)benzoic acid.
| Compound Name | 3-[(3-fluorophenyl)sulfonylamino]-4-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 46291743 |
| Molecular Formula | C18H20FN3O4S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-[(3-fluorophenyl)sulfonylamino]-4-(4-methylpiperazin-1-yl)benzoic acid |
| SMILES | CN1CCN(c2ccc(C(=O)O)cc2NS(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H20FN3O4S/c1-21-7-9-22(10-8-21)17-6-5-13(18(23)24)11-16(17)20-27(25,26)15-4-2-3-14(19)12-15/h2-6,11-12,20H,7-10H2,1H3,(H,23,24) |
| InChIKey | JECFCKIXKTULNF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |