C18H19F4N3O2S — CID 8860759
4-fluoro-N-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 8860759) has the molecular formula C18H19F4N3O2S and a molecular weight of 417.43 g/mol. Its IUPAC name is 4-fluoro-N-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8860759 |
| Molecular Formula | C18H19F4N3O2S |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 4-fluoro-N-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CN1CCN(c2ccc(C(F)(F)F)cc2NS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H19F4N3O2S/c1-24-8-10-25(11-9-24)17-7-2-13(18(20,21)22)12-16(17)23-28(26,27)15-5-3-14(19)4-6-15/h2-7,12,23H,8-11H2,1H3 |
| InChIKey | ZISQKSPXJFJGBB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |