C21H26F3N3O2S — CID 172808620
N-[2-(4-tert-butylpiperazin-1-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 172808620) has the molecular formula C21H26F3N3O2S and a molecular weight of 441.52 g/mol. Its IUPAC name is N-[2-(4-tert-butylpiperazin-1-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(4-tert-butylpiperazin-1-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 172808620 |
| Molecular Formula | C21H26F3N3O2S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[2-(4-tert-butylpiperazin-1-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)(C)N1CCN(c2ccccc2NS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H26F3N3O2S/c1-20(2,3)27-14-12-26(13-15-27)19-7-5-4-6-18(19)25-30(28,29)17-10-8-16(9-11-17)21(22,23)24/h4-11,25H,12-15H2,1-3H3 |
| InChIKey | RVZBRVRPWROKNG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |