C18H21F3N2O2S — CID 47074325
4-tert-butyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzenesulfonamide (PubChem CID 47074325) has the molecular formula C18H21F3N2O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47074325 |
| Molecular Formula | C18H21F3N2O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-tert-butyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccccc2NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3N2O2S/c1-17(2,3)13-8-10-14(11-9-13)26(24,25)23-16-7-5-4-6-15(16)22-12-18(19,20)21/h4-11,22-23H,12H2,1-3H3 |
| InChIKey | SUYPSYYBMYADJK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |