C14H12F4N2O2S — CID 47784131
2-fluoro-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzenesulfonamide (PubChem CID 47784131) has the molecular formula C14H12F4N2O2S and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47784131 |
| Molecular Formula | C14H12F4N2O2S |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-fluoro-N-[2-(2,2,2-trifluoroethylamino)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1NCC(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C14H12F4N2O2S/c15-10-5-1-4-8-13(10)23(21,22)20-12-7-3-2-6-11(12)19-9-14(16,17)18/h1-8,19-20H,9H2 |
| InChIKey | LCLYJKSHNRHQPZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |