C15H12F4N2O3S — CID 8843582
2-[(2-fluorophenyl)sulfonylamino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 8843582) has the molecular formula C15H12F4N2O3S and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 8843582 |
| Molecular Formula | C15H12F4N2O3S |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccccc1NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C15H12F4N2O3S/c16-11-6-2-4-8-13(11)25(23,24)21-12-7-3-1-5-10(12)14(22)20-9-15(17,18)19/h1-8,21H,9H2,(H,20,22) |
| InChIKey | KAKRBQDTIOCCJO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |