C16H13ClF3N3O5S — CID 24502358
2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 24502358) has the molecular formula C16H13ClF3N3O5S and a molecular weight of 451.81 g/mol. Its IUPAC name is 2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 24502358 |
| Molecular Formula | C16H13ClF3N3O5S |
| Molecular Weight | 451.81 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)Nc2ccccc2C(=O)NCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13ClF3N3O5S/c1-9-12(17)6-10(7-14(9)23(25)26)29(27,28)22-13-5-3-2-4-11(13)15(24)21-8-16(18,19)20/h2-7,22H,8H2,1H3,(H,21,24) |
| InChIKey | AVZQCYPDKSSWRX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|