C17H14F3N3O4 — CID 34756914
2-[[2-(2-nitrophenyl)acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 34756914) has the molecular formula C17H14F3N3O4 and a molecular weight of 381.31 g/mol. Its IUPAC name is 2-[[2-(2-nitrophenyl)acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[2-(2-nitrophenyl)acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 34756914 |
| Molecular Formula | C17H14F3N3O4 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-[[2-(2-nitrophenyl)acetyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])Nc1ccccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C17H14F3N3O4/c18-17(19,20)10-21-16(25)12-6-2-3-7-13(12)22-15(24)9-11-5-1-4-8-14(11)23(26)27/h1-8H,9-10H2,(H,21,25)(H,22,24) |
| InChIKey | LQUPGDBFZICMEY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|