C9H6BrF3N2O3 — CID 113367081
2-bromo-3-nitro-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 113367081) has the molecular formula C9H6BrF3N2O3 and a molecular weight of 327.06 g/mol. Its IUPAC name is 2-bromo-3-nitro-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-bromo-3-nitro-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 113367081 |
| Molecular Formula | C9H6BrF3N2O3 |
| Molecular Weight | 327.06 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 2-bromo-3-nitro-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C9H6BrF3N2O3/c10-7-5(2-1-3-6(7)15(17)18)8(16)14-4-9(11,12)13/h1-3H,4H2,(H,14,16) |
| InChIKey | ZDSPIQBUQUZRSH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.06 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|