C9H9F3N4O3 — CID 113333584
3-hydrazinyl-2-nitro-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 113333584) has the molecular formula C9H9F3N4O3 and a molecular weight of 278.19 g/mol. Its IUPAC name is 3-hydrazinyl-2-nitro-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-hydrazinyl-2-nitro-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 113333584 |
| Molecular Formula | C9H9F3N4O3 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 3-hydrazinyl-2-nitro-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NNc1cccc(C(=O)NCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9F3N4O3/c10-9(11,12)4-14-8(17)5-2-1-3-6(15-13)7(5)16(18)19/h1-3,15H,4,13H2,(H,14,17) |
| InChIKey | ZYOUYVKTCFSYDK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|