C10H12ClF2N3O4S — CID 114384018
N-(3-amino-2,2-difluoropropyl)-3-chloro-4-methyl-5-nitrobenzenesulfonamide (PubChem CID 114384018) has the molecular formula C10H12ClF2N3O4S and a molecular weight of 343.74 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-3-chloro-4-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-3-chloro-4-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 114384018 |
| Molecular Formula | C10H12ClF2N3O4S |
| Molecular Weight | 343.74 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-3-chloro-4-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)NCC(F)(F)CN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12ClF2N3O4S/c1-6-8(11)2-7(3-9(6)16(17)18)21(19,20)15-5-10(12,13)4-14/h2-3,15H,4-5,14H2,1H3 |
| InChIKey | SKUPPMKHEXZFPC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.74 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|