C10H10BrClN2O4S — CID 113465024
N-(2-bromoprop-2-enyl)-3-chloro-4-methyl-5-nitrobenzenesulfonamide (PubChem CID 113465024) has the molecular formula C10H10BrClN2O4S and a molecular weight of 369.62 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-3-chloro-4-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-bromoprop-2-enyl)-3-chloro-4-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 113465024 |
| Molecular Formula | C10H10BrClN2O4S |
| Molecular Weight | 369.62 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-3-chloro-4-methyl-5-nitrobenzenesulfonamide |
| SMILES | C=C(Br)CNS(=O)(=O)c1cc(Cl)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10BrClN2O4S/c1-6(11)5-13-19(17,18)8-3-9(12)7(2)10(4-8)14(15)16/h3-4,13H,1,5H2,2H3 |
| InChIKey | GTCZQDUJCPWVGW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|