C11H14ClN3O5S — CID 8800472
2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-N-ethylacetamide (PubChem CID 8800472) has the molecular formula C11H14ClN3O5S and a molecular weight of 335.77 g/mol. Its IUPAC name is 2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-N-ethylacetamide.
| Compound Name | 2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 8800472 |
| Molecular Formula | C11H14ClN3O5S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNS(=O)(=O)c1cc(Cl)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14ClN3O5S/c1-3-13-11(16)6-14-21(19,20)8-4-9(12)7(2)10(5-8)15(17)18/h4-5,14H,3,6H2,1-2H3,(H,13,16) |
| InChIKey | JAZKLZSBOUBERI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|