C19H16ClN3O6S2 — CID 27993527
3-chloro-4-methyl-5-nitro-N-[4-(phenylsulfamoyl)phenyl]benzenesulfonamide (PubChem CID 27993527) has the molecular formula C19H16ClN3O6S2 and a molecular weight of 481.94 g/mol. Its IUPAC name is 3-chloro-4-methyl-5-nitro-N-[4-(phenylsulfamoyl)phenyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methyl-5-nitro-N-[4-(phenylsulfamoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27993527 |
| Molecular Formula | C19H16ClN3O6S2 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | 3-chloro-4-methyl-5-nitro-N-[4-(phenylsulfamoyl)phenyl]benzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccccc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16ClN3O6S2/c1-13-18(20)11-17(12-19(13)23(24)25)31(28,29)22-15-7-9-16(10-8-15)30(26,27)21-14-5-3-2-4-6-14/h2-12,21-22H,1H3 |
| InChIKey | HNVHAIXSBSUOLM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|