C14H10ClN3O5S2 — CID 75534001
3-chloro-4-methyl-5-nitro-N-(2-oxo-3H-1,3-benzothiazol-6-yl)benzenesulfonamide (PubChem CID 75534001) has the molecular formula C14H10ClN3O5S2 and a molecular weight of 399.84 g/mol. Its IUPAC name is 3-chloro-4-methyl-5-nitro-N-(2-oxo-3H-1,3-benzothiazol-6-yl)benzenesulfonamide.
| Compound Name | 3-chloro-4-methyl-5-nitro-N-(2-oxo-3H-1,3-benzothiazol-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75534001 |
| Molecular Formula | C14H10ClN3O5S2 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 3-chloro-4-methyl-5-nitro-N-(2-oxo-3H-1,3-benzothiazol-6-yl)benzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)Nc2ccc3[nH]c(=O)sc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10ClN3O5S2/c1-7-10(15)5-9(6-12(7)18(20)21)25(22,23)17-8-2-3-11-13(4-8)24-14(19)16-11/h2-6,17H,1H3,(H,16,19) |
| InChIKey | PGCDLKPPVDDVQG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 122.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|