C18H17ClN4O5S — CID 60587241
3-chloro-4-methyl-5-nitro-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 60587241) has the molecular formula C18H17ClN4O5S and a molecular weight of 436.88 g/mol. Its IUPAC name is 3-chloro-4-methyl-5-nitro-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methyl-5-nitro-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 60587241 |
| Molecular Formula | C18H17ClN4O5S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 3-chloro-4-methyl-5-nitro-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)Nc2ccc3nc(C4CCCO4)[nH]c3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17ClN4O5S/c1-10-13(19)8-12(9-16(10)23(24)25)29(26,27)22-11-4-5-14-15(7-11)21-18(20-14)17-3-2-6-28-17/h4-5,7-9,17,22H,2-3,6H2,1H3,(H,20,21) |
| InChIKey | KZUBBAMCZLIGHM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|