C17H15F2N3O3S — CID 47826091
2,4-difluoro-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 47826091) has the molecular formula C17H15F2N3O3S and a molecular weight of 379.39 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 47826091 |
| Molecular Formula | C17H15F2N3O3S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2,4-difluoro-N-[2-(oxolan-2-yl)-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2nc(C3CCCO3)[nH]c2c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F2N3O3S/c18-10-3-6-16(12(19)8-10)26(23,24)22-11-4-5-13-14(9-11)21-17(20-13)15-2-1-7-25-15/h3-6,8-9,15,22H,1-2,7H2,(H,20,21) |
| InChIKey | FNKZYBXGRKZKCP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |