C15H15ClN2O5S — CID 60534366
3-chloro-N-(3-ethoxyphenyl)-4-methyl-5-nitrobenzenesulfonamide (PubChem CID 60534366) has the molecular formula C15H15ClN2O5S and a molecular weight of 370.81 g/mol. Its IUPAC name is 3-chloro-N-(3-ethoxyphenyl)-4-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 3-chloro-N-(3-ethoxyphenyl)-4-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 60534366 |
| Molecular Formula | C15H15ClN2O5S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 3-chloro-N-(3-ethoxyphenyl)-4-methyl-5-nitrobenzenesulfonamide |
| SMILES | CCOc1cccc(NS(=O)(=O)c2cc(Cl)c(C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C15H15ClN2O5S/c1-3-23-12-6-4-5-11(7-12)17-24(21,22)13-8-14(16)10(2)15(9-13)18(19)20/h4-9,17H,3H2,1-2H3 |
| InChIKey | LZDCUAXAJVMMLY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|