C15H13ClN6O4S2 — CID 38892727
3-chloro-4-methyl-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-5-nitrobenzenesulfonamide (PubChem CID 38892727) has the molecular formula C15H13ClN6O4S2 and a molecular weight of 440.89 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-5-nitrobenzenesulfonamide.
| Compound Name | 3-chloro-4-methyl-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 38892727 |
| Molecular Formula | C15H13ClN6O4S2 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 3-chloro-4-methyl-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-5-nitrobenzenesulfonamide |
| SMILES | CSc1nnnn1-c1cccc(NS(=O)(=O)c2cc(Cl)c(C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C15H13ClN6O4S2/c1-9-13(16)7-12(8-14(9)22(23)24)28(25,26)18-10-4-3-5-11(6-10)21-15(27-2)17-19-20-21/h3-8,18H,1-2H3 |
| InChIKey | VOEAFKCGDSXKKT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|