C16H15N5O5S2 — CID 55603694
4-methoxy-3-[[3-(5-methylsulfanyltetrazol-1-yl)phenyl]sulfamoyl]benzoic acid (PubChem CID 55603694) has the molecular formula C16H15N5O5S2 and a molecular weight of 421.46 g/mol. Its IUPAC name is 4-methoxy-3-[[3-(5-methylsulfanyltetrazol-1-yl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-methoxy-3-[[3-(5-methylsulfanyltetrazol-1-yl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 55603694 |
| Molecular Formula | C16H15N5O5S2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 4-methoxy-3-[[3-(5-methylsulfanyltetrazol-1-yl)phenyl]sulfamoyl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cccc(-n2nnnc2SC)c1 |
| InChI | InChI=1S/C16H15N5O5S2/c1-26-13-7-6-10(15(22)23)8-14(13)28(24,25)18-11-4-3-5-12(9-11)21-16(27-2)17-19-20-21/h3-9,18H,1-2H3,(H,22,23) |
| InChIKey | OAANBTPNUARWQS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |