C14H12N6OS — CID 51078036
N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]pyridine-4-carboxamide (PubChem CID 51078036) has the molecular formula C14H12N6OS and a molecular weight of 312.36 g/mol. Its IUPAC name is N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 51078036 |
| Molecular Formula | C14H12N6OS |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]pyridine-4-carboxamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C14H12N6OS/c1-22-14-17-18-19-20(14)12-4-2-3-11(9-12)16-13(21)10-5-7-15-8-6-10/h2-9H,1H3,(H,16,21) |
| InChIKey | XXKKAPLOQJGVLL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |