C15H13N5OS — CID 38679670
N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide (PubChem CID 38679670) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 38679670 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H13N5OS/c1-22-15-17-18-19-20(15)13-9-5-8-12(10-13)16-14(21)11-6-3-2-4-7-11/h2-10H,1H3,(H,16,21) |
| InChIKey | UXFGKRDKYFLKCE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |