C19H19N5OS — CID 134034450
N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1-phenylcyclobutane-1-carboxamide (PubChem CID 134034450) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1-phenylcyclobutane-1-carboxamide.
| Compound Name | N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1-phenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 134034450 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1-phenylcyclobutane-1-carboxamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)C2(c3ccccc3)CCC2)c1 |
| InChI | InChI=1S/C19H19N5OS/c1-26-18-21-22-23-24(18)16-10-5-9-15(13-16)20-17(25)19(11-6-12-19)14-7-3-2-4-8-14/h2-5,7-10,13H,6,11-12H2,1H3,(H,20,25) |
| InChIKey | GALAIIJCNDTDRT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |