C15H12IN5OS — CID 38679629
4-iodo-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide (PubChem CID 38679629) has the molecular formula C15H12IN5OS and a molecular weight of 437.27 g/mol. Its IUPAC name is 4-iodo-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 4-iodo-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 38679629 |
| Molecular Formula | C15H12IN5OS |
| Molecular Weight | 437.27 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | 4-iodo-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C15H12IN5OS/c1-23-15-18-19-20-21(15)13-4-2-3-12(9-13)17-14(22)10-5-7-11(16)8-6-10/h2-9H,1H3,(H,17,22) |
| InChIKey | APUIDUQXFQBTPH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|