C19H21FN6O3S2 — CID 55608986
3-(diethylsulfamoyl)-4-fluoro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide (PubChem CID 55608986) has the molecular formula C19H21FN6O3S2 and a molecular weight of 464.55 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-fluoro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-4-fluoro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55608986 |
| Molecular Formula | C19H21FN6O3S2 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-fluoro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2cccc(-n3nnnc3SC)c2)ccc1F |
| InChI | InChI=1S/C19H21FN6O3S2/c1-4-25(5-2)31(28,29)17-11-13(9-10-16(17)20)18(27)21-14-7-6-8-15(12-14)26-19(30-3)22-23-24-26/h6-12H,4-5H2,1-3H3,(H,21,27) |
| InChIKey | TVHWMTVYJZHKPU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |