C21H26N6O3S2 — CID 55609222
3-[4-(diethylsulfamoyl)phenyl]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]propanamide (PubChem CID 55609222) has the molecular formula C21H26N6O3S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]propanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 55609222 |
| Molecular Formula | C21H26N6O3S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)Nc2cccc(-n3nnnc3SC)c2)cc1 |
| InChI | InChI=1S/C21H26N6O3S2/c1-4-26(5-2)32(29,30)19-12-9-16(10-13-19)11-14-20(28)22-17-7-6-8-18(15-17)27-21(31-3)23-24-25-27/h6-10,12-13,15H,4-5,11,14H2,1-3H3,(H,22,28) |
| InChIKey | IKTQUEZTJUGYEL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |