C17H18N6OS — CID 38679896
3-(dimethylamino)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide (PubChem CID 38679896) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 38679896 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 3-(dimethylamino)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2cccc(N(C)C)c2)c1 |
| InChI | InChI=1S/C17H18N6OS/c1-22(2)14-8-4-6-12(10-14)16(24)18-13-7-5-9-15(11-13)23-17(25-3)19-20-21-23/h4-11H,1-3H3,(H,18,24) |
| InChIKey | KOTNQTMESWDDTI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |