C15H11BrClN5OS — CID 39126999
5-bromo-2-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide (PubChem CID 39126999) has the molecular formula C15H11BrClN5OS and a molecular weight of 424.71 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 39126999 |
| Molecular Formula | C15H11BrClN5OS |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 422.96 |
| IUPAC Name | 5-bromo-2-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2cc(Br)ccc2Cl)c1 |
| InChI | InChI=1S/C15H11BrClN5OS/c1-24-15-19-20-21-22(15)11-4-2-3-10(8-11)18-14(23)12-7-9(16)5-6-13(12)17/h2-8H,1H3,(H,18,23) |
| InChIKey | ASQZNJPQBJYKDA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |