C17H12ClN5OS2 — CID 55608971
3-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 55608971) has the molecular formula C17H12ClN5OS2 and a molecular weight of 401.90 g/mol. Its IUPAC name is 3-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55608971 |
| Molecular Formula | C17H12ClN5OS2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 3-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C17H12ClN5OS2/c1-25-17-20-21-22-23(17)11-6-4-5-10(9-11)19-16(24)15-14(18)12-7-2-3-8-13(12)26-15/h2-9H,1H3,(H,19,24) |
| InChIKey | FAUQBMAWXXTDQU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |