C11H8ClN5OS — CID 925650
3-chloro-N-(1-methyltetrazol-5-yl)-1-benzothiophene-2-carboxamide (PubChem CID 925650) has the molecular formula C11H8ClN5OS and a molecular weight of 293.74 g/mol. Its IUPAC name is 3-chloro-N-(1-methyltetrazol-5-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(1-methyltetrazol-5-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 925650 |
| Molecular Formula | C11H8ClN5OS |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 3-chloro-N-(1-methyltetrazol-5-yl)-1-benzothiophene-2-carboxamide |
| SMILES | Cn1nnnc1NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C11H8ClN5OS/c1-17-11(14-15-16-17)13-10(18)9-8(12)6-4-2-3-5-7(6)19-9/h2-5H,1H3,(H,13,14,16,18) |
| InChIKey | FZLAUHDJHGRVAV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |