C10H6ClN5OS — CID 2851499
3-chloro-N-(2H-tetrazol-5-yl)-1-benzothiophene-2-carboxamide (PubChem CID 2851499) has the molecular formula C10H6ClN5OS and a molecular weight of 279.71 g/mol. Its IUPAC name is 3-chloro-N-(2H-tetrazol-5-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(2H-tetrazol-5-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2851499 |
| Molecular Formula | C10H6ClN5OS |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 3-chloro-N-(2H-tetrazol-5-yl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1nn[nH]n1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C10H6ClN5OS/c11-7-5-3-1-2-4-6(5)18-8(7)9(17)12-10-13-15-16-14-10/h1-4H,(H2,12,13,14,15,16,17) |
| InChIKey | QAKMHRVEFACHMO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |