C17H13ClN6OS — CID 56510585
6-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1H-indole-2-carboxamide (PubChem CID 56510585) has the molecular formula C17H13ClN6OS and a molecular weight of 384.85 g/mol. Its IUPAC name is 6-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 56510585 |
| Molecular Formula | C17H13ClN6OS |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 6-chloro-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-1H-indole-2-carboxamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2cc3ccc(Cl)cc3[nH]2)c1 |
| InChI | InChI=1S/C17H13ClN6OS/c1-26-17-21-22-23-24(17)13-4-2-3-12(9-13)19-16(25)15-7-10-5-6-11(18)8-14(10)20-15/h2-9,20H,1H3,(H,19,25) |
| InChIKey | KLUZGHPNQVFXHA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |