C20H19N7O2S — CID 55870096
4-[(1-methylimidazol-2-yl)methoxy]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide (PubChem CID 55870096) has the molecular formula C20H19N7O2S and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-[(1-methylimidazol-2-yl)methoxy]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 4-[(1-methylimidazol-2-yl)methoxy]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55870096 |
| Molecular Formula | C20H19N7O2S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 4-[(1-methylimidazol-2-yl)methoxy]-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]benzamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)c2ccc(OCc3nccn3C)cc2)c1 |
| InChI | InChI=1S/C20H19N7O2S/c1-26-11-10-21-18(26)13-29-17-8-6-14(7-9-17)19(28)22-15-4-3-5-16(12-15)27-20(30-2)23-24-25-27/h3-12H,13H2,1-2H3,(H,22,28) |
| InChIKey | LQUKHTOGCBEFNZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |