C23H24N4O4 — CID 55869064
4-[(1-methylimidazol-2-yl)methoxy]-N-[3-(morpholine-4-carbonyl)phenyl]benzamide (PubChem CID 55869064) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-[(1-methylimidazol-2-yl)methoxy]-N-[3-(morpholine-4-carbonyl)phenyl]benzamide.
| Compound Name | 4-[(1-methylimidazol-2-yl)methoxy]-N-[3-(morpholine-4-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55869064 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[(1-methylimidazol-2-yl)methoxy]-N-[3-(morpholine-4-carbonyl)phenyl]benzamide |
| SMILES | Cn1ccnc1COc1ccc(C(=O)Nc2cccc(C(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C23H24N4O4/c1-26-10-9-24-21(26)16-31-20-7-5-17(6-8-20)22(28)25-19-4-2-3-18(15-19)23(29)27-11-13-30-14-12-27/h2-10,15H,11-14,16H2,1H3,(H,25,28) |
| InChIKey | ZRVDPRQIYRXRRP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |