C21H23N7O2S — CID 47033942
4-benzamido-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]piperidine-1-carboxamide (PubChem CID 47033942) has the molecular formula C21H23N7O2S and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-benzamido-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-benzamido-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47033942 |
| Molecular Formula | C21H23N7O2S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-benzamido-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]piperidine-1-carboxamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)N2CCC(NC(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H23N7O2S/c1-31-21-24-25-26-28(21)18-9-5-8-17(14-18)23-20(30)27-12-10-16(11-13-27)22-19(29)15-6-3-2-4-7-15/h2-9,14,16H,10-13H2,1H3,(H,22,29)(H,23,30) |
| InChIKey | NHAJBLJFEOSUDL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |