C13H16N6O3S — CID 122078184
4-[[3-(5-methylsulfanyltetrazol-1-yl)phenyl]carbamoylamino]butanoic acid (PubChem CID 122078184) has the molecular formula C13H16N6O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is 4-[[3-(5-methylsulfanyltetrazol-1-yl)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[3-(5-methylsulfanyltetrazol-1-yl)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122078184 |
| Molecular Formula | C13H16N6O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-[[3-(5-methylsulfanyltetrazol-1-yl)phenyl]carbamoylamino]butanoic acid |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)NCCCC(=O)O)c1 |
| InChI | InChI=1S/C13H16N6O3S/c1-23-13-16-17-18-19(13)10-5-2-4-9(8-10)15-12(22)14-7-3-6-11(20)21/h2,4-5,8H,3,6-7H2,1H3,(H,20,21)(H2,14,15,22) |
| InChIKey | HAOZPVQDAVIIJL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|