C19H18N8OS — CID 166180390
1-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]urea (PubChem CID 166180390) has the molecular formula C19H18N8OS and a molecular weight of 406.48 g/mol. Its IUPAC name is 1-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]urea.
| Compound Name | 1-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 166180390 |
| Molecular Formula | C19H18N8OS |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-3-[[4-(1H-pyrazol-5-yl)phenyl]methyl]urea |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)NCc2ccc(-c3ccn[nH]3)cc2)c1 |
| InChI | InChI=1S/C19H18N8OS/c1-29-19-24-25-26-27(19)16-4-2-3-15(11-16)22-18(28)20-12-13-5-7-14(8-6-13)17-9-10-21-23-17/h2-11H,12H2,1H3,(H,21,23)(H2,20,22,28) |
| InChIKey | NMQZIKXKUDXHFL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |