C17H17N5O3S — CID 55909410
1-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-3-(3-sulfamoylphenyl)urea (PubChem CID 55909410) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-3-(3-sulfamoylphenyl)urea.
| Compound Name | 1-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-3-(3-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 55909410 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-3-(3-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)NCc2ccc(-c3ccn[nH]3)cc2)c1 |
| InChI | InChI=1S/C17H17N5O3S/c18-26(24,25)15-3-1-2-14(10-15)21-17(23)19-11-12-4-6-13(7-5-12)16-8-9-20-22-16/h1-10H,11H2,(H,20,22)(H2,18,24,25)(H2,19,21,23) |
| InChIKey | FUHQZNDZWWLOHD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |