C14H15N3O3S — CID 51970987
1-phenyl-3-[(3-sulfamoylphenyl)methyl]urea (PubChem CID 51970987) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-phenyl-3-[(3-sulfamoylphenyl)methyl]urea.
| Compound Name | 1-phenyl-3-[(3-sulfamoylphenyl)methyl]urea |
|---|---|
| PubChem CID | 51970987 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-phenyl-3-[(3-sulfamoylphenyl)methyl]urea |
| SMILES | NS(=O)(=O)c1cccc(CNC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C14H15N3O3S/c15-21(19,20)13-8-4-5-11(9-13)10-16-14(18)17-12-6-2-1-3-7-12/h1-9H,10H2,(H2,15,19,20)(H2,16,17,18) |
| InChIKey | VHNFMOVINDLTMI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |