C11H14N2O5S2 — CID 104569122
2-[2-oxo-2-[(3-sulfamoylphenyl)methylamino]ethyl]sulfanylacetic acid (PubChem CID 104569122) has the molecular formula C11H14N2O5S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-[2-oxo-2-[(3-sulfamoylphenyl)methylamino]ethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-[(3-sulfamoylphenyl)methylamino]ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569122 |
| Molecular Formula | C11H14N2O5S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-[2-oxo-2-[(3-sulfamoylphenyl)methylamino]ethyl]sulfanylacetic acid |
| SMILES | NS(=O)(=O)c1cccc(CNC(=O)CSCC(=O)O)c1 |
| InChI | InChI=1S/C11H14N2O5S2/c12-20(17,18)9-3-1-2-8(4-9)5-13-10(14)6-19-7-11(15)16/h1-4H,5-7H2,(H,13,14)(H,15,16)(H2,12,17,18) |
| InChIKey | KORCJQBLMHVCNI-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |