C15H15BrN2O4S — CID 166221897
2-(4-bromo-2-hydroxyphenyl)-N-[(3-sulfamoylphenyl)methyl]acetamide (PubChem CID 166221897) has the molecular formula C15H15BrN2O4S and a molecular weight of 399.27 g/mol. Its IUPAC name is 2-(4-bromo-2-hydroxyphenyl)-N-[(3-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-(4-bromo-2-hydroxyphenyl)-N-[(3-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 166221897 |
| Molecular Formula | C15H15BrN2O4S |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 2-(4-bromo-2-hydroxyphenyl)-N-[(3-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1cccc(CNC(=O)Cc2ccc(Br)cc2O)c1 |
| InChI | InChI=1S/C15H15BrN2O4S/c16-12-5-4-11(14(19)8-12)7-15(20)18-9-10-2-1-3-13(6-10)23(17,21)22/h1-6,8,19H,7,9H2,(H,18,20)(H2,17,21,22) |
| InChIKey | SXLFDLIFZBACIO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |