C18H21BrN2O3S — CID 55852739
5-(4-bromophenyl)-N-[(3-sulfamoylphenyl)methyl]pentanamide (PubChem CID 55852739) has the molecular formula C18H21BrN2O3S and a molecular weight of 425.35 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[(3-sulfamoylphenyl)methyl]pentanamide.
| Compound Name | 5-(4-bromophenyl)-N-[(3-sulfamoylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 55852739 |
| Molecular Formula | C18H21BrN2O3S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 5-(4-bromophenyl)-N-[(3-sulfamoylphenyl)methyl]pentanamide |
| SMILES | NS(=O)(=O)c1cccc(CNC(=O)CCCCc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C18H21BrN2O3S/c19-16-10-8-14(9-11-16)4-1-2-7-18(22)21-13-15-5-3-6-17(12-15)25(20,23)24/h3,5-6,8-12H,1-2,4,7,13H2,(H,21,22)(H2,20,23,24) |
| InChIKey | VNBGKZOLDLMBGR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|